C28H31ClN6O5S — CID 19691180
N-[4-[[4-[4-[2-[(3-amino-1H-indol-5-yl)oxy]acetyl]piperazin-1-yl]phenyl]sulfamoyl]phenyl]acetamide;hydrochloride (PubChem CID 19691180) has the molecular formula C28H31ClN6O5S and a molecular weight of 599.11 g/mol. Its IUPAC name is N-[4-[[4-[4-[2-[(3-amino-1H-indol-5-yl)oxy]acetyl]piperazin-1-yl]phenyl]sulfamoyl]phenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[[4-[4-[2-[(3-amino-1H-indol-5-yl)oxy]acetyl]piperazin-1-yl]phenyl]sulfamoyl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 19691180 |
| Molecular Formula | C28H31ClN6O5S |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | N-[4-[[4-[4-[2-[(3-amino-1H-indol-5-yl)oxy]acetyl]piperazin-1-yl]phenyl]sulfamoyl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(N3CCN(C(=O)COc4ccc5[nH]cc(N)c5c4)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C28H30N6O5S.ClH/c1-19(35)31-20-4-9-24(10-5-20)40(37,38)32-21-2-6-22(7-3-21)33-12-14-34(15-13-33)28(36)18-39-23-8-11-27-25(16-23)26(29)17-30-27;/h2-11,16-17,30,32H,12-15,18,29H2,1H3,(H,31,35);1H |
| InChIKey | VQQGXPPBIQIJTO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|