C30H33N5O3 — CID 19691157
N-[4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]phenyl]-2-phenylacetamide (PubChem CID 19691157) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]phenyl]-2-phenylacetamide.
| Compound Name | N-[4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 19691157 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-[4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]phenyl]-2-phenylacetamide |
| SMILES | NCCc1c[nH]c2ccc(OCC(=O)N3CCN(c4ccc(NC(=O)Cc5ccccc5)cc4)CC3)cc12 |
| InChI | InChI=1S/C30H33N5O3/c31-13-12-23-20-32-28-11-10-26(19-27(23)28)38-21-30(37)35-16-14-34(15-17-35)25-8-6-24(7-9-25)33-29(36)18-22-4-2-1-3-5-22/h1-11,19-20,32H,12-18,21,31H2,(H,33,36) |
| InChIKey | XOVUHGPBDCAJJR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|