C29H31N5O5 — CID 139980576
2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[2-(2-methoxyphenyl)-4-nitrophenyl]piperazin-1-yl]ethanone (PubChem CID 139980576) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[2-(2-methoxyphenyl)-4-nitrophenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[2-(2-methoxyphenyl)-4-nitrophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 139980576 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-1-[4-[2-(2-methoxyphenyl)-4-nitrophenyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccccc1-c1cc([N+](=O)[O-])ccc1N1CCN(C(=O)COc2ccc3[nH]cc(CCN)c3c2)CC1 |
| InChI | InChI=1S/C29H31N5O5/c1-38-28-5-3-2-4-23(28)25-16-21(34(36)37)6-9-27(25)32-12-14-33(15-13-32)29(35)19-39-22-7-8-26-24(17-22)20(10-11-30)18-31-26/h2-9,16-18,31H,10-15,19,30H2,1H3 |
| InChIKey | MFBOFICADDLWIS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|