C15H13BrClN2O4P — CID 11453249
(4-aminophenyl)methyl (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate (PubChem CID 11453249) has the molecular formula C15H13BrClN2O4P and a molecular weight of 431.61 g/mol. Its IUPAC name is (4-aminophenyl)methyl (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate.
| Compound Name | (4-aminophenyl)methyl (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 11453249 |
| Molecular Formula | C15H13BrClN2O4P |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | (4-aminophenyl)methyl (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate |
| SMILES | Nc1ccc(COP(=O)(O)Oc2c[nH]c3ccc(Br)c(Cl)c23)cc1 |
| InChI | InChI=1S/C15H13BrClN2O4P/c16-11-5-6-12-14(15(11)17)13(7-19-12)23-24(20,21)22-8-9-1-3-10(18)4-2-9/h1-7,19H,8,18H2,(H,20,21) |
| InChIKey | DXZYBEBVAWEGAG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|