C15H17BrClN2O5P — CID 174435153
5-bromo-4-chloro-1H-indol-3-ol;4-methylaniline;phosphoric acid (PubChem CID 174435153) has the molecular formula C15H17BrClN2O5P and a molecular weight of 451.64 g/mol. Its IUPAC name is 5-bromo-4-chloro-1H-indol-3-ol;4-methylaniline;phosphoric acid.
| Compound Name | 5-bromo-4-chloro-1H-indol-3-ol;4-methylaniline;phosphoric acid |
|---|---|
| PubChem CID | 174435153 |
| Molecular Formula | C15H17BrClN2O5P |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 5-bromo-4-chloro-1H-indol-3-ol;4-methylaniline;phosphoric acid |
| SMILES | Cc1ccc(N)cc1.O=P(O)(O)O.Oc1c[nH]c2ccc(Br)c(Cl)c12 |
| InChI | InChI=1S/C8H5BrClNO.C7H9N.H3O4P/c9-4-1-2-5-7(8(4)10)6(12)3-11-5;1-6-2-4-7(8)5-3-6;1-5(2,3)4/h1-3,11-12H;2-5H,8H2,1H3;(H3,1,2,3,4) |
| InChIKey | MHUCGDPJNOUEHD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|