C14H16BrClNO9P — CID 67541642
[(2S,3S,5R,6S)-1-(5-bromo-4-chloro-1H-indol-3-yl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate (PubChem CID 67541642) has the molecular formula C14H16BrClNO9P and a molecular weight of 488.61 g/mol. Its IUPAC name is [(2S,3S,5R,6S)-1-(5-bromo-4-chloro-1H-indol-3-yl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(2S,3S,5R,6S)-1-(5-bromo-4-chloro-1H-indol-3-yl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67541642 |
| Molecular Formula | C14H16BrClNO9P |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 486.94 |
| IUPAC Name | [(2S,3S,5R,6S)-1-(5-bromo-4-chloro-1H-indol-3-yl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1(c2c[nH]c3ccc(Br)c(Cl)c23)[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16BrClNO9P/c15-5-1-2-6-7(8(5)16)4(3-17-6)14(26-27(23,24)25)12(21)10(19)9(18)11(20)13(14)22/h1-3,9-13,17-22H,(H2,23,24,25)/t9?,10-,11+,12-,13-,14?/m0/s1 |
| InChIKey | CPSZHHLOEXEOBS-OBYRSOGISA-N |
| XLogP | -0.29 |
| TPSA | 183.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|