C15H15BrClN2O4P — CID 24801987
(5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate;(4-methylphenyl)azanium (PubChem CID 24801987) has the molecular formula C15H15BrClN2O4P and a molecular weight of 433.63 g/mol. Its IUPAC name is (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate;(4-methylphenyl)azanium.
| Compound Name | (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate;(4-methylphenyl)azanium |
|---|---|
| PubChem CID | 24801987 |
| Molecular Formula | C15H15BrClN2O4P |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | (5-bromo-4-chloro-1H-indol-3-yl) hydrogen phosphate;(4-methylphenyl)azanium |
| SMILES | Cc1ccc([NH3+])cc1.O=P([O-])(O)Oc1c[nH]c2ccc(Br)c(Cl)c12 |
| InChI | InChI=1S/C8H6BrClNO4P.C7H9N/c9-4-1-2-5-7(8(4)10)6(3-11-5)15-16(12,13)14;1-6-2-4-7(8)5-3-6/h1-3,11H,(H2,12,13,14);2-5H,8H2,1H3 |
| InChIKey | QEIFSLUFHRCVQL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|