C16H15BrClN2O5P — CID 175471413
(5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylbenzamide (PubChem CID 175471413) has the molecular formula C16H15BrClN2O5P and a molecular weight of 461.64 g/mol. Its IUPAC name is (5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylbenzamide.
| Compound Name | (5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylbenzamide |
|---|---|
| PubChem CID | 175471413 |
| Molecular Formula | C16H15BrClN2O5P |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | (5-bromo-4-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1.O=P(O)(O)Oc1c[nH]c2ccc(Br)c(Cl)c12 |
| InChI | InChI=1S/C8H6BrClNO4P.C8H9NO/c9-4-1-2-5-7(8(4)10)6(3-11-5)15-16(12,13)14;1-6-2-4-7(5-3-6)8(9)10/h1-3,11H,(H2,12,13,14);2-5H,1H3,(H2,9,10) |
| InChIKey | CJFRXPHSHUCQBC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|