C14H16BrClNO10P — CID 174758469
(5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl] hydrogen phosphate (PubChem CID 174758469) has the molecular formula C14H16BrClNO10P and a molecular weight of 504.61 g/mol. Its IUPAC name is (5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl] hydrogen phosphate.
| Compound Name | (5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 174758469 |
| Molecular Formula | C14H16BrClNO10P |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 502.94 |
| IUPAC Name | (5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl] hydrogen phosphate |
| SMILES | O=P(O)(Oc1c[nH]c2ccc(Br)c(Cl)c12)OC1(O)[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16BrClNO10P/c15-4-1-2-5-7(8(4)16)6(3-17-5)26-28(24,25)27-14(23)12(21)10(19)9(18)11(20)13(14)22/h1-3,9-13,17-23H,(H,24,25)/t9?,10-,11+,12-,13-,14?/m1/s1 |
| InChIKey | ISYFKEDSPRLHNH-BWXUFHDPSA-N |
| XLogP | -0.41 |
| TPSA | 192.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|