C8H7BrClKNO4P — CID 175419743
potassium;5-bromo-4-chloro-1,3-dihydroindol-3-ide;phosphoric acid (PubChem CID 175419743) has the molecular formula C8H7BrClKNO4P and a molecular weight of 366.58 g/mol. Its IUPAC name is potassium;5-bromo-4-chloro-1,3-dihydroindol-3-ide;phosphoric acid.
| Compound Name | potassium;5-bromo-4-chloro-1,3-dihydroindol-3-ide;phosphoric acid |
|---|---|
| PubChem CID | 175419743 |
| Molecular Formula | C8H7BrClKNO4P |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 364.86 |
| IUPAC Name | potassium;5-bromo-4-chloro-1,3-dihydroindol-3-ide;phosphoric acid |
| SMILES | Clc1c(Br)ccc2[nH]c[c-]c12.O=P(O)(O)O.[K+] |
| InChI | InChI=1S/C8H4BrClN.K.H3O4P/c9-6-1-2-7-5(8(6)10)3-4-11-7;;1-5(2,3)4/h1-2,4,11H;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | FFTITAFSEWTJFH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|