C16H14BrN3O — CID 63116424
5-amino-N-(2-bromo-4-methylphenyl)-1H-indole-3-carboxamide (PubChem CID 63116424) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-amino-N-(2-bromo-4-methylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-amino-N-(2-bromo-4-methylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63116424 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-amino-N-(2-bromo-4-methylphenyl)-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c[nH]c3ccc(N)cc23)c(Br)c1 |
| InChI | InChI=1S/C16H14BrN3O/c1-9-2-4-15(13(17)6-9)20-16(21)12-8-19-14-5-3-10(18)7-11(12)14/h2-8,19H,18H2,1H3,(H,20,21) |
| InChIKey | FMKVPBDWMNQTQO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|