C15H11Br2N3O — CID 107596138
5-amino-N-(2,6-dibromophenyl)-1H-indole-3-carboxamide (PubChem CID 107596138) has the molecular formula C15H11Br2N3O and a molecular weight of 409.08 g/mol. Its IUPAC name is 5-amino-N-(2,6-dibromophenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-amino-N-(2,6-dibromophenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 107596138 |
| Molecular Formula | C15H11Br2N3O |
| Molecular Weight | 409.08 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 5-amino-N-(2,6-dibromophenyl)-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2[nH]cc(C(=O)Nc3c(Br)cccc3Br)c2c1 |
| InChI | InChI=1S/C15H11Br2N3O/c16-11-2-1-3-12(17)14(11)20-15(21)10-7-19-13-5-4-8(18)6-9(10)13/h1-7,19H,18H2,(H,20,21) |
| InChIKey | OPFDMCXYJMNKDD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.08 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|