C19H24N2O4P+ — CID 147653836
2-[4-[hydroxy(phenylmethoxy)phosphoryl]oxy-1H-indol-3-yl]ethyl-dimethylazanium (PubChem CID 147653836) has the molecular formula C19H24N2O4P+ and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[4-[hydroxy(phenylmethoxy)phosphoryl]oxy-1H-indol-3-yl]ethyl-dimethylazanium.
| Compound Name | 2-[4-[hydroxy(phenylmethoxy)phosphoryl]oxy-1H-indol-3-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 147653836 |
| Molecular Formula | C19H24N2O4P+ |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[4-[hydroxy(phenylmethoxy)phosphoryl]oxy-1H-indol-3-yl]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCc1c[nH]c2cccc(OP(=O)(O)OCc3ccccc3)c12 |
| InChI | InChI=1S/C19H23N2O4P/c1-21(2)12-11-16-13-20-17-9-6-10-18(19(16)17)25-26(22,23)24-14-15-7-4-3-5-8-15/h3-10,13,20H,11-12,14H2,1-2H3,(H,22,23)/p+1 |
| InChIKey | GKAIYZRUCXEQSP-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|