C20H23N2O2S2+ — CID 176800426
2-[4-(benzyldisulfanyl)carbonyloxy-1H-indol-3-yl]ethyl-dimethylazanium (PubChem CID 176800426) has the molecular formula C20H23N2O2S2+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[4-(benzyldisulfanyl)carbonyloxy-1H-indol-3-yl]ethyl-dimethylazanium.
| Compound Name | 2-[4-(benzyldisulfanyl)carbonyloxy-1H-indol-3-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 176800426 |
| Molecular Formula | C20H23N2O2S2+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[4-(benzyldisulfanyl)carbonyloxy-1H-indol-3-yl]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCc1c[nH]c2cccc(OC(=O)SSCc3ccccc3)c12 |
| InChI | InChI=1S/C20H22N2O2S2/c1-22(2)12-11-16-13-21-17-9-6-10-18(19(16)17)24-20(23)26-25-14-15-7-4-3-5-8-15/h3-10,13,21H,11-12,14H2,1-2H3/p+1 |
| InChIKey | BVLCJHALROWOJT-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|