C20H23N2O2+ — CID 162488036
[2-(4-benzoyloxy-1H-indol-3-yl)-1,1-dideuterioethyl]-trimethylazanium (PubChem CID 162488036) has the molecular formula C20H23N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is [2-(4-benzoyloxy-1H-indol-3-yl)-1,1-dideuterioethyl]-trimethylazanium.
| Compound Name | [2-(4-benzoyloxy-1H-indol-3-yl)-1,1-dideuterioethyl]-trimethylazanium |
|---|---|
| PubChem CID | 162488036 |
| Molecular Formula | C20H23N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [2-(4-benzoyloxy-1H-indol-3-yl)-1,1-dideuterioethyl]-trimethylazanium |
| SMILES | [2H]C([2H])(Cc1c[nH]c2cccc(OC(=O)c3ccccc3)c12)[N+](C)(C)C |
| InChI | InChI=1S/C20H23N2O2/c1-22(2,3)13-12-16-14-21-17-10-7-11-18(19(16)17)24-20(23)15-8-5-4-6-9-15/h4-11,14,21H,12-13H2,1-3H3/q+1/i13D2 |
| InChIKey | ZPGHMKVVTLTOQI-KLTYLHELSA-N |
| XLogP | 3.64 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|