C19H29N3O2 — CID 176651508
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 3,3,4,4-tetradeuterio-4-(dimethylamino)-2-methylbutanoate (PubChem CID 176651508) has the molecular formula C19H29N3O2 and a molecular weight of 335.48 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 3,3,4,4-tetradeuterio-4-(dimethylamino)-2-methylbutanoate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 3,3,4,4-tetradeuterio-4-(dimethylamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 176651508 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 3,3,4,4-tetradeuterio-4-(dimethylamino)-2-methylbutanoate |
| SMILES | [2H]C([2H])(C(C)C(=O)Oc1cccc2[nH]cc(CCN(C)C)c12)C([2H])([2H])N(C)C |
| InChI | InChI=1S/C19H29N3O2/c1-14(9-11-21(2)3)19(23)24-17-8-6-7-16-18(17)15(13-20-16)10-12-22(4)5/h6-8,13-14,20H,9-12H2,1-5H3/i9D2,11D2 |
| InChIKey | ASUXCPZRHKEBGB-ZXVMGSATSA-N |
| XLogP | 2.77 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|