C19H28N2O2S2 — CID 170212186
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2,3-dimethylbutan-2-yldisulfanyl)formate (PubChem CID 170212186) has the molecular formula C19H28N2O2S2 and a molecular weight of 380.58 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2,3-dimethylbutan-2-yldisulfanyl)formate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2,3-dimethylbutan-2-yldisulfanyl)formate |
|---|---|
| PubChem CID | 170212186 |
| Molecular Formula | C19H28N2O2S2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2,3-dimethylbutan-2-yldisulfanyl)formate |
| SMILES | CC(C)C(C)(C)SSC(=O)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C19H28N2O2S2/c1-13(2)19(3,4)25-24-18(22)23-16-9-7-8-15-17(16)14(12-20-15)10-11-21(5)6/h7-9,12-13,20H,10-11H2,1-6H3 |
| InChIKey | JWNWXKQYZIIWBU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|