C28H34N4O6 — CID 175530702
bis[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3-dihydroxybutanedioate (PubChem CID 175530702) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is bis[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 175530702 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | bis[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3-dihydroxybutanedioate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)C(O)C(O)C(=O)Oc3cccc4[nH]cc(CCN(C)C)c34)c12 |
| InChI | InChI=1S/C28H34N4O6/c1-31(2)13-11-17-15-29-19-7-5-9-21(23(17)19)37-27(35)25(33)26(34)28(36)38-22-10-6-8-20-24(22)18(16-30-20)12-14-32(3)4/h5-10,15-16,25-26,29-30,33-34H,11-14H2,1-4H3 |
| InChIKey | YBDAJDURSWNGEI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|