C18H26N2O2S2 — CID 170212264
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (3-methylbutan-2-yldisulfanyl)formate (PubChem CID 170212264) has the molecular formula C18H26N2O2S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (3-methylbutan-2-yldisulfanyl)formate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (3-methylbutan-2-yldisulfanyl)formate |
|---|---|
| PubChem CID | 170212264 |
| Molecular Formula | C18H26N2O2S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (3-methylbutan-2-yldisulfanyl)formate |
| SMILES | CC(C)C(C)SSC(=O)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C18H26N2O2S2/c1-12(2)13(3)23-24-18(21)22-16-8-6-7-15-17(16)14(11-19-15)9-10-20(4)5/h6-8,11-13,19H,9-10H2,1-5H3 |
| InChIKey | BYFAOFKKUCPESU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|