C14H21N2O4P — CID 156821130
1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethylphosphonic acid (PubChem CID 156821130) has the molecular formula C14H21N2O4P and a molecular weight of 312.31 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethylphosphonic acid.
| Compound Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 156821130 |
| Molecular Formula | C14H21N2O4P |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethylphosphonic acid |
| SMILES | CC(Oc1cccc2[nH]cc(CCN(C)C)c12)P(=O)(O)O |
| InChI | InChI=1S/C14H21N2O4P/c1-10(21(17,18)19)20-13-6-4-5-12-14(13)11(9-15-12)7-8-16(2)3/h4-6,9-10,15H,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | DRAOUYQMKHANEI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|