C18H24N2O5 — CID 176589010
1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl oxetan-3-yl carbonate (PubChem CID 176589010) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl oxetan-3-yl carbonate.
| Compound Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl oxetan-3-yl carbonate |
|---|---|
| PubChem CID | 176589010 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl oxetan-3-yl carbonate |
| SMILES | CC(OC(=O)OC1COC1)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C18H24N2O5/c1-12(24-18(21)25-14-10-22-11-14)23-16-6-4-5-15-17(16)13(9-19-15)7-8-20(2)3/h4-6,9,12,14,19H,7-8,10-11H2,1-3H3 |
| InChIKey | BMJDBPHJVVSNDZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|