C16H21N3O2 — CID 176589045
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] azetidine-3-carboxylate (PubChem CID 176589045) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] azetidine-3-carboxylate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] azetidine-3-carboxylate |
|---|---|
| PubChem CID | 176589045 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] azetidine-3-carboxylate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)C3CNC3)c12 |
| InChI | InChI=1S/C16H21N3O2/c1-19(2)7-6-11-10-18-13-4-3-5-14(15(11)13)21-16(20)12-8-17-9-12/h3-5,10,12,17-18H,6-9H2,1-2H3 |
| InChIKey | MBELWHMPLQELLX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|