C42H48N6O6 — CID 176651480
tris[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (Z)-prop-1-ene-1,2,3-tricarboxylate (PubChem CID 176651480) has the molecular formula C42H48N6O6 and a molecular weight of 732.88 g/mol. Its IUPAC name is tris[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (Z)-prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | tris[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (Z)-prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 176651480 |
| Molecular Formula | C42H48N6O6 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | tris[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (Z)-prop-1-ene-1,2,3-tricarboxylate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)/C=C(/CC(=O)Oc3cccc4[nH]cc(CCN(C)C)c34)C(=O)Oc3cccc4[nH]cc(CCN(C)C)c34)c12 |
| InChI | InChI=1S/C42H48N6O6/c1-46(2)19-16-27-24-43-31-10-7-13-34(39(27)31)52-37(49)22-30(42(51)54-36-15-9-12-33-41(36)29(26-45-33)18-21-48(5)6)23-38(50)53-35-14-8-11-32-40(35)28(25-44-32)17-20-47(3)4/h7-15,22,24-26,43-45H,16-21,23H2,1-6H3/b30-22- |
| InChIKey | YQOAWFZPMVWUNW-SWKFRHMKSA-N |
| XLogP | 5.88 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|