C23H35N3O4 — CID 167476985
tert-butyl 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxycarbonyl-methylamino]pentanoate (PubChem CID 167476985) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxycarbonyl-methylamino]pentanoate.
| Compound Name | tert-butyl 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxycarbonyl-methylamino]pentanoate |
|---|---|
| PubChem CID | 167476985 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxycarbonyl-methylamino]pentanoate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)N(C)CCCCC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C23H35N3O4/c1-23(2,3)30-20(27)12-7-8-14-26(6)22(28)29-19-11-9-10-18-21(19)17(16-24-18)13-15-25(4)5/h9-11,16,24H,7-8,12-15H2,1-6H3 |
| InChIKey | ODBMCKXOWRUTOJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|