C18H26N2O2 — CID 176651518
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2R)-2,3-dimethylbutanoate (PubChem CID 176651518) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2R)-2,3-dimethylbutanoate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2R)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 176651518 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] (2R)-2,3-dimethylbutanoate |
| SMILES | CC(C)[C@@H](C)C(=O)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)13(3)18(21)22-16-8-6-7-15-17(16)14(11-19-15)9-10-20(4)5/h6-8,11-13,19H,9-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | DHVNLAUPJTWXGP-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|