C19H28N2O2 — CID 167476981
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate (PubChem CID 167476981) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 167476981 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)CCC(C)(C)C)c12 |
| InChI | InChI=1S/C19H28N2O2/c1-19(2,3)11-9-17(22)23-16-8-6-7-15-18(16)14(13-20-15)10-12-21(4)5/h6-8,13,20H,9-12H2,1-5H3 |
| InChIKey | QDRZRPUVXSBWCU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|