C18H24N2O5 — CID 176651472
4-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-2-oxoethoxy]butanoic acid (PubChem CID 176651472) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-2-oxoethoxy]butanoic acid.
| Compound Name | 4-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-2-oxoethoxy]butanoic acid |
|---|---|
| PubChem CID | 176651472 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]-2-oxoethoxy]butanoic acid |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)COCCCC(=O)O)c12 |
| InChI | InChI=1S/C18H24N2O5/c1-20(2)9-8-13-11-19-14-5-3-6-15(18(13)14)25-17(23)12-24-10-4-7-16(21)22/h3,5-6,11,19H,4,7-10,12H2,1-2H3,(H,21,22) |
| InChIKey | XXLSAZPSBOCPOB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|