C21H32N2O3 — CID 167476980
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate;ethenol (PubChem CID 167476980) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate;ethenol.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate;ethenol |
|---|---|
| PubChem CID | 167476980 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 4,4-dimethylpentanoate;ethenol |
| SMILES | C=CO.CN(C)CCc1c[nH]c2cccc(OC(=O)CCC(C)(C)C)c12 |
| InChI | InChI=1S/C19H28N2O2.C2H4O/c1-19(2,3)11-9-17(22)23-16-8-6-7-15-18(16)14(13-20-15)10-12-21(4)5;1-2-3/h6-8,13,20H,9-12H2,1-5H3;2-3H,1H2 |
| InChIKey | HVJFLSYFGDWOIP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|