C26H42N2O2 — CID 176917034
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3,3,4,5,6,6-heptamethylheptanoate (PubChem CID 176917034) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3,3,4,5,6,6-heptamethylheptanoate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3,3,4,5,6,6-heptamethylheptanoate |
|---|---|
| PubChem CID | 176917034 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] 2,3,3,4,5,6,6-heptamethylheptanoate |
| SMILES | CC(C(C)C(C)(C)C(C)C(=O)Oc1cccc2[nH]cc(CCN(C)C)c12)C(C)(C)C |
| InChI | InChI=1S/C26H42N2O2/c1-17(25(4,5)6)18(2)26(7,8)19(3)24(29)30-22-13-11-12-21-23(22)20(16-27-21)14-15-28(9)10/h11-13,16-19,27H,14-15H2,1-10H3 |
| InChIKey | WULDAQLMDWVQLM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|