C19H28N2O2 — CID 177196026
[3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl] hexanoate (PubChem CID 177196026) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is [3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl] hexanoate.
| Compound Name | [3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl] hexanoate |
|---|---|
| PubChem CID | 177196026 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1cccc2[nH]cc(CCN(C)CC)c12 |
| InChI | InChI=1S/C19H28N2O2/c1-4-6-7-11-18(22)23-17-10-8-9-16-19(17)15(14-20-16)12-13-21(3)5-2/h8-10,14,20H,4-7,11-13H2,1-3H3 |
| InChIKey | OFCVKXNQBXRFBE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|