C16H20N2O4 — CID 167476958
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] oxetan-3-yl carbonate (PubChem CID 167476958) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] oxetan-3-yl carbonate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] oxetan-3-yl carbonate |
|---|---|
| PubChem CID | 167476958 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] oxetan-3-yl carbonate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)OC3COC3)c12 |
| InChI | InChI=1S/C16H20N2O4/c1-18(2)7-6-11-8-17-13-4-3-5-14(15(11)13)22-16(19)21-12-9-20-10-12/h3-5,8,12,17H,6-7,9-10H2,1-2H3 |
| InChIKey | DGUWDFOVSBNNTA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|