C17H23N3O3 — CID 167476998
[3-[2-(methylamino)ethyl]-1H-indol-4-yl] piperidin-4-yl carbonate (PubChem CID 167476998) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is [3-[2-(methylamino)ethyl]-1H-indol-4-yl] piperidin-4-yl carbonate.
| Compound Name | [3-[2-(methylamino)ethyl]-1H-indol-4-yl] piperidin-4-yl carbonate |
|---|---|
| PubChem CID | 167476998 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [3-[2-(methylamino)ethyl]-1H-indol-4-yl] piperidin-4-yl carbonate |
| SMILES | CNCCc1c[nH]c2cccc(OC(=O)OC3CCNCC3)c12 |
| InChI | InChI=1S/C17H23N3O3/c1-18-8-5-12-11-20-14-3-2-4-15(16(12)14)23-17(21)22-13-6-9-19-10-7-13/h2-4,11,13,18-20H,5-10H2,1H3 |
| InChIKey | ZMTGNAQJWGNOJT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|