About [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate
[3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate (PubChem CID 177196034) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate |
| PubChem CID | 177196034 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate |
| SMILES | CCNCCc1c[nH]c2cccc(OC(=O)CC(C)(C)C)c12 |
| InChI | InChI=1S/C18H26N2O2/c1-5-19-10-9-13-12-20-14-7-6-8-15(17(13)14)22-16(21)11-18(2,3)4/h6-8,12,19-20H,5,9-11H2,1-4H3 |
| InChIKey | MGSRUJHGSGBQTE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate?
The IUPAC name of [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate (CID 177196034) is [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate.
What is the SMILES notation for [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate?
The canonical SMILES for [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate is CCNCCc1c[nH]c2cccc(OC(=O)CC(C)(C)C)c12.
What is the InChIKey of [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate?
The InChIKey is MGSRUJHGSGBQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2/c1-5-19-10-9-13-12-20-14-7-6-8-15(17(13)14)22-16(21)11-18(2,3)4/h6-8,12,19-20H,5,9-11H2,1-4H3.
What are the key properties of [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate?
[3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate has a molecular weight of 302.42 g/mol, XLogP of 3.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(ethylamino)ethyl]-1H-indol-4-yl] 3,3-dimethylbutanoate is sourced from PubChem (CID 177196034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).