C14H16N2O4 — CID 90793163
(3-nitro-1H-indol-4-yl) 3,3-dimethylbutanoate (PubChem CID 90793163) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (3-nitro-1H-indol-4-yl) 3,3-dimethylbutanoate.
| Compound Name | (3-nitro-1H-indol-4-yl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90793163 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3-nitro-1H-indol-4-yl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1cccc2[nH]cc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C14H16N2O4/c1-14(2,3)7-12(17)20-11-6-4-5-9-13(11)10(8-15-9)16(18)19/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | UQSWBFVHFIYQLE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|