C24H27N5O6 — CID 162088287
2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid;2-amino-2-methyl-3-(4-nitro-1H-indol-3-yl)propanoic acid (PubChem CID 162088287) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid;2-amino-2-methyl-3-(4-nitro-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid;2-amino-2-methyl-3-(4-nitro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 162088287 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)-2-methylpropanoic acid;2-amino-2-methyl-3-(4-nitro-1H-indol-3-yl)propanoic acid |
| SMILES | CC(N)(Cc1c[nH]c2cccc([N+](=O)[O-])c12)C(=O)O.CC(N)(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C12H13N3O4.C12H14N2O2/c1-12(13,11(16)17)5-7-6-14-8-3-2-4-9(10(7)8)15(18)19;1-12(13,11(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-4,6,14H,5,13H2,1H3,(H,16,17);2-5,7,14H,6,13H2,1H3,(H,15,16) |
| InChIKey | ZDGMIFXSEKNMTJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 201.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|