C22H27N5O4 — CID 159595836
(2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol;(2S)-2-amino-3-(4-nitro-1H-indol-3-yl)propan-1-ol (PubChem CID 159595836) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol;(2S)-2-amino-3-(4-nitro-1H-indol-3-yl)propan-1-ol.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol;(2S)-2-amino-3-(4-nitro-1H-indol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 159595836 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propan-1-ol;(2S)-2-amino-3-(4-nitro-1H-indol-3-yl)propan-1-ol |
| SMILES | N[C@H](CO)Cc1c[nH]c2cccc([N+](=O)[O-])c12.N[C@H](CO)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H13N3O3.C11H14N2O/c12-8(6-15)4-7-5-13-9-2-1-3-10(11(7)9)14(16)17;12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-3,5,8,13,15H,4,6,12H2;1-4,6,9,13-14H,5,7,12H2/t8-;9-/m00/s1 |
| InChIKey | MKVCTRLUPWDHLG-SGZVIHCFSA-N |
| XLogP | 1.97 |
| TPSA | 167.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|