C14H18N2O2 — CID 164700571
[3-[2-deuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate (PubChem CID 164700571) has the molecular formula C14H18N2O2 and a molecular weight of 247.32 g/mol. Its IUPAC name is [3-[2-deuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate.
| Compound Name | [3-[2-deuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate |
|---|---|
| PubChem CID | 164700571 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | [3-[2-deuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate |
| SMILES | [2H]C(Cc1c[nH]c2cccc(OC(C)=O)c12)N(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-10(17)18-13-6-4-5-12-14(13)11(9-15-12)7-8-16(2)3/h4-6,9,15H,7-8H2,1-3H3/i8D |
| InChIKey | RTLRUOSYLFOFHV-BNEYPBHNSA-N |
| XLogP | 2.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|