C26H36N4O2 — CID 177084987
[3-[2-[[benzyl-[3-(dimethylamino)propyl]amino]-ethylamino]ethyl]-1H-indol-4-yl] acetate (PubChem CID 177084987) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is [3-[2-[[benzyl-[3-(dimethylamino)propyl]amino]-ethylamino]ethyl]-1H-indol-4-yl] acetate.
| Compound Name | [3-[2-[[benzyl-[3-(dimethylamino)propyl]amino]-ethylamino]ethyl]-1H-indol-4-yl] acetate |
|---|---|
| PubChem CID | 177084987 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [3-[2-[[benzyl-[3-(dimethylamino)propyl]amino]-ethylamino]ethyl]-1H-indol-4-yl] acetate |
| SMILES | CCN(CCc1c[nH]c2cccc(OC(C)=O)c12)N(CCCN(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C26H36N4O2/c1-5-29(30(17-10-16-28(3)4)20-22-11-7-6-8-12-22)18-15-23-19-27-24-13-9-14-25(26(23)24)32-21(2)31/h6-9,11-14,19,27H,5,10,15-18,20H2,1-4H3 |
| InChIKey | IUMWKYTVXORQEM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|