C17H23IN2O2 — CID 170646986
2-(4-acetyloxy-1H-indol-3-yl)ethyl-dimethyl-prop-2-enylazanium iodide (PubChem CID 170646986) has the molecular formula C17H23IN2O2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-(4-acetyloxy-1H-indol-3-yl)ethyl-dimethyl-prop-2-enylazanium iodide.
| Compound Name | 2-(4-acetyloxy-1H-indol-3-yl)ethyl-dimethyl-prop-2-enylazanium iodide |
|---|---|
| PubChem CID | 170646986 |
| Molecular Formula | C17H23IN2O2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-(4-acetyloxy-1H-indol-3-yl)ethyl-dimethyl-prop-2-enylazanium iodide |
| SMILES | C=CC[N+](C)(C)CCc1c[nH]c2cccc(OC(C)=O)c12.[I-] |
| InChI | InChI=1S/C17H23N2O2.HI/c1-5-10-19(3,4)11-9-14-12-18-15-7-6-8-16(17(14)15)21-13(2)20;/h5-8,12,18H,1,9-11H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | UUPPYRAGBSYRBP-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|