C21H23F2N2O3+ — CID 169186126
2-[4-(3,5-difluoro-4-methoxybenzoyl)oxy-1H-indol-3-yl]ethyl-trimethylazanium (PubChem CID 169186126) has the molecular formula C21H23F2N2O3+ and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[4-(3,5-difluoro-4-methoxybenzoyl)oxy-1H-indol-3-yl]ethyl-trimethylazanium.
| Compound Name | 2-[4-(3,5-difluoro-4-methoxybenzoyl)oxy-1H-indol-3-yl]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 169186126 |
| Molecular Formula | C21H23F2N2O3+ |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[4-(3,5-difluoro-4-methoxybenzoyl)oxy-1H-indol-3-yl]ethyl-trimethylazanium |
| SMILES | COc1c(F)cc(C(=O)Oc2cccc3[nH]cc(CC[N+](C)(C)C)c23)cc1F |
| InChI | InChI=1S/C21H23F2N2O3/c1-25(2,3)9-8-13-12-24-17-6-5-7-18(19(13)17)28-21(26)14-10-15(22)20(27-4)16(23)11-14/h5-7,10-12,24H,8-9H2,1-4H3/q+1 |
| InChIKey | XKYXHCNCORMHNH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|