C22H27N2O5+ — CID 176800442
dimethyl-[2-[4-(3,4,5-trimethoxybenzoyl)oxy-1H-indol-3-yl]ethyl]azanium (PubChem CID 176800442) has the molecular formula C22H27N2O5+ and a molecular weight of 399.47 g/mol. Its IUPAC name is dimethyl-[2-[4-(3,4,5-trimethoxybenzoyl)oxy-1H-indol-3-yl]ethyl]azanium.
| Compound Name | dimethyl-[2-[4-(3,4,5-trimethoxybenzoyl)oxy-1H-indol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 176800442 |
| Molecular Formula | C22H27N2O5+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | dimethyl-[2-[4-(3,4,5-trimethoxybenzoyl)oxy-1H-indol-3-yl]ethyl]azanium |
| SMILES | COc1cc(C(=O)Oc2cccc3[nH]cc(CC[NH+](C)C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O5/c1-24(2)10-9-14-13-23-16-7-6-8-17(20(14)16)29-22(25)15-11-18(26-3)21(28-5)19(12-15)27-4/h6-8,11-13,23H,9-10H2,1-5H3/p+1 |
| InChIKey | SGMQUMPYQBTJRF-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|