C12H18N2O4P+ — CID 160527949
dimethyl-[2-(4-phosphonooxy-1H-indol-3-yl)ethyl]azanium (PubChem CID 160527949) has the molecular formula C12H18N2O4P+ and a molecular weight of 285.26 g/mol. Its IUPAC name is dimethyl-[2-(4-phosphonooxy-1H-indol-3-yl)ethyl]azanium.
| Compound Name | dimethyl-[2-(4-phosphonooxy-1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 160527949 |
| Molecular Formula | C12H18N2O4P+ |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | dimethyl-[2-(4-phosphonooxy-1H-indol-3-yl)ethyl]azanium |
| SMILES | C[NH+](C)CCc1c[nH]c2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C12H17N2O4P/c1-14(2)7-6-9-8-13-10-4-3-5-11(12(9)10)18-19(15,16)17/h3-5,8,13H,6-7H2,1-2H3,(H2,15,16,17)/p+1 |
| InChIKey | QVDSEJDULKLHCG-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|