C28H35N4O4P — CID 170759995
bis[3-(2-pyrrolidin-1-ylethyl)-1H-indol-4-yl] hydrogen phosphate (PubChem CID 170759995) has the molecular formula C28H35N4O4P and a molecular weight of 522.59 g/mol. Its IUPAC name is bis[3-(2-pyrrolidin-1-ylethyl)-1H-indol-4-yl] hydrogen phosphate.
| Compound Name | bis[3-(2-pyrrolidin-1-ylethyl)-1H-indol-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 170759995 |
| Molecular Formula | C28H35N4O4P |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | bis[3-(2-pyrrolidin-1-ylethyl)-1H-indol-4-yl] hydrogen phosphate |
| SMILES | O=P(O)(Oc1cccc2[nH]cc(CCN3CCCC3)c12)Oc1cccc2[nH]cc(CCN3CCCC3)c12 |
| InChI | InChI=1S/C28H35N4O4P/c33-37(34,35-25-9-5-7-23-27(25)21(19-29-23)11-17-31-13-1-2-14-31)36-26-10-6-8-24-28(26)22(20-30-24)12-18-32-15-3-4-16-32/h5-10,19-20,29-30H,1-4,11-18H2,(H,33,34) |
| InChIKey | SRWULMTVGQROAQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|