C28H37N4O4P — CID 170760021
(3-methyl-1H-indol-4-yl) [3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-4-yl] hydrogen phosphate;1-methylpyrrolidine (PubChem CID 170760021) has the molecular formula C28H37N4O4P and a molecular weight of 524.60 g/mol. Its IUPAC name is (3-methyl-1H-indol-4-yl) [3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-4-yl] hydrogen phosphate;1-methylpyrrolidine.
| Compound Name | (3-methyl-1H-indol-4-yl) [3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-4-yl] hydrogen phosphate;1-methylpyrrolidine |
|---|---|
| PubChem CID | 170760021 |
| Molecular Formula | C28H37N4O4P |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (3-methyl-1H-indol-4-yl) [3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indol-4-yl] hydrogen phosphate;1-methylpyrrolidine |
| SMILES | CN1CCCC1.Cc1c[nH]c2cccc(OP(=O)(O)Oc3cccc4[nH]cc(CC5CCCN5C)c34)c12 |
| InChI | InChI=1S/C23H26N3O4P.C5H11N/c1-15-13-24-18-7-3-9-20(22(15)18)29-31(27,28)30-21-10-4-8-19-23(21)16(14-25-19)12-17-6-5-11-26(17)2;1-6-4-2-3-5-6/h3-4,7-10,13-14,17,24-25H,5-6,11-12H2,1-2H3,(H,27,28);2-5H2,1H3 |
| InChIKey | JWLAQOVBGPDAID-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|