C15H20N2 — CID 163470216
3-[dideuterio-[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-4-methyl-1H-indole (PubChem CID 163470216) has the molecular formula C15H20N2 and a molecular weight of 233.37 g/mol. Its IUPAC name is 3-[dideuterio-[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-4-methyl-1H-indole.
| Compound Name | 3-[dideuterio-[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-4-methyl-1H-indole |
|---|---|
| PubChem CID | 163470216 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 233.37 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3-[dideuterio-[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-4-methyl-1H-indole |
| SMILES | [2H]C([2H])(c1c[nH]c2cccc(C)c12)[C@H]1CCCN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H20N2/c1-11-5-3-7-14-15(11)12(10-16-14)9-13-6-4-8-17(13)2/h3,5,7,10,13,16H,4,6,8-9H2,1-2H3/t13-/m1/s1/i2D3,9D2 |
| InChIKey | BVYCZARMDZRLMA-WJKPNBINSA-N |
| XLogP | 3.11 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |