C27H29N3O4 — CID 170760018
1-O-(3-methyl-1H-indol-4-yl) 4-O-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] butanedioate (PubChem CID 170760018) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-O-(3-methyl-1H-indol-4-yl) 4-O-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] butanedioate.
| Compound Name | 1-O-(3-methyl-1H-indol-4-yl) 4-O-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] butanedioate |
|---|---|
| PubChem CID | 170760018 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-O-(3-methyl-1H-indol-4-yl) 4-O-[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] butanedioate |
| SMILES | Cc1c[nH]c2cccc(OC(=O)CCC(=O)Oc3cccc4[nH]cc(C[C@H]5CCCN5C)c34)c12 |
| InChI | InChI=1S/C27H29N3O4/c1-17-15-28-20-7-3-9-22(26(17)20)33-24(31)11-12-25(32)34-23-10-4-8-21-27(23)18(16-29-21)14-19-6-5-13-30(19)2/h3-4,7-10,15-16,19,28-29H,5-6,11-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | HQJLDPFTHBVYGS-LJQANCHMSA-N |
| XLogP | 4.89 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|