C16H20F2N2O — CID 178091747
4-(difluoromethoxy)-2-methyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 178091747) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-methyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 4-(difluoromethoxy)-2-methyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 178091747 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-(difluoromethoxy)-2-methyl-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | Cc1[nH]c2cccc(OC(F)F)c2c1C[C@H]1CCCN1C |
| InChI | InChI=1S/C16H20F2N2O/c1-10-12(9-11-5-4-8-20(11)2)15-13(19-10)6-3-7-14(15)21-16(17)18/h3,6-7,11,16,19H,4-5,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZXUSQZDQTBKPRS-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |