C18H23FN2S — CID 178091577
2-cyclopropyl-4-(fluoromethylsulfanyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 178091577) has the molecular formula C18H23FN2S and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-cyclopropyl-4-(fluoromethylsulfanyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 2-cyclopropyl-4-(fluoromethylsulfanyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 178091577 |
| Molecular Formula | C18H23FN2S |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-cyclopropyl-4-(fluoromethylsulfanyl)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | CN1CCC[C@@H]1Cc1c(C2CC2)[nH]c2cccc(SCF)c12 |
| InChI | InChI=1S/C18H23FN2S/c1-21-9-3-4-13(21)10-14-17-15(20-18(14)12-7-8-12)5-2-6-16(17)22-11-19/h2,5-6,12-13,20H,3-4,7-11H2,1H3/t13-/m1/s1 |
| InChIKey | CPSHIJCHECIWLC-CYBMUJFWSA-N |
| XLogP | 4.70 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |