C20H23N3O — CID 178091685
4-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2-pyridin-2-yl-1H-indole (PubChem CID 178091685) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2-pyridin-2-yl-1H-indole.
| Compound Name | 4-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2-pyridin-2-yl-1H-indole |
|---|---|
| PubChem CID | 178091685 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2-pyridin-2-yl-1H-indole |
| SMILES | COc1cccc2[nH]c(-c3ccccn3)c(C[C@H]3CCCN3C)c12 |
| InChI | InChI=1S/C20H23N3O/c1-23-12-6-7-14(23)13-15-19-16(9-5-10-18(19)24-2)22-20(15)17-8-3-4-11-21-17/h3-5,8-11,14,22H,6-7,12-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | QGEPQYKHASLYKV-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |