C17H21FN2 — CID 178091734
2-cyclopropyl-4-fluoro-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 178091734) has the molecular formula C17H21FN2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-cyclopropyl-4-fluoro-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 2-cyclopropyl-4-fluoro-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 178091734 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-cyclopropyl-4-fluoro-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | [2H]C([2H])([2H])N1CCC[C@@H]1Cc1c(C2CC2)[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C17H21FN2/c1-20-9-3-4-12(20)10-13-16-14(18)5-2-6-15(16)19-17(13)11-7-8-11/h2,5-6,11-12,19H,3-4,7-10H2,1H3/t12-/m1/s1/i1D3 |
| InChIKey | UUIZXOPZYUHPBA-LBBMYNEISA-N |
| XLogP | 3.82 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |